Why use the shorter chemical names when you can use the IUPAC name: N-(4-hydroxy... | Hacker News

Hacker Newsnew | past | comments | ask | show | jobs | submit

		jleyank 4 months ago \| parent \| context \| favorite \| on: Acetaminophen and Autism Why use the shorter chemical names when you can use the IUPAC name: N-(4-hydroxyphenyl)acetamide. If you’re talking about a chemical rather than a product, there’s established nomenclature rules. Or, if you’re a computer type, use the SMILES notation CC(=O)Nc1ccc(O)cc1.

gilleain 4 months ago [–]

Very true. I refer to it by the InChI :

InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10)

Or the key Key:RZVAJINKPMORJF-UHFFFAOYSA-N

Guidelines | FAQ | Lists | API | Security | Legal | Apply to YC | Contact